About 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride
2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride (PubChem CID 21082862) has the molecular formula C11H20Cl2N4
and a molecular weight of 279.22 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride |
| PubChem CID | 21082862 |
| Molecular Formula | C11H20Cl2N4 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride |
| SMILES | CC1CCC(C)N1c1ncc(N)cc1N.Cl.Cl |
| InChI | InChI=1S/C11H18N4.2ClH/c1-7-3-4-8(2)15(7)11-10(13)5-9(12)6-14-11;;/h5-8H,3-4,12-13H2,1-2H3;2*1H |
| InChIKey | LRRBNGHZOOSNMA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride?
The IUPAC name of 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride (CID 21082862) is 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride.
What is the SMILES notation for 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride?
The canonical SMILES for 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride is CC1CCC(C)N1c1ncc(N)cc1N.Cl.Cl.
What is the InChIKey of 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride?
The InChIKey is LRRBNGHZOOSNMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4.2ClH/c1-7-3-4-8(2)15(7)11-10(13)5-9(12)6-14-11;;/h5-8H,3-4,12-13H2,1-2H3;2*1H.
What are the key properties of 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride?
2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride has a molecular weight of 279.22 g/mol, XLogP of 2.47, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine;dihydrochloride is sourced from PubChem (CID 21082862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).