C11H18N4 — CID 21082863
2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine (PubChem CID 21082863) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine.
| Compound Name | 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 21082863 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine |
| SMILES | CC1CCC(C)N1c1ncc(N)cc1N |
| InChI | InChI=1S/C11H18N4/c1-7-3-4-8(2)15(7)11-10(13)5-9(12)6-14-11/h5-8H,3-4,12-13H2,1-2H3 |
| InChIKey | FDCCUJSBMGQICI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |