About 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine
2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine (PubChem CID 21082863) has the molecular formula C11H18N4
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine.
Molecular Properties
| Compound Name | 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine |
| PubChem CID | 21082863 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine |
| SMILES | CC1CCC(C)N1c1ncc(N)cc1N |
| InChI | InChI=1S/C11H18N4/c1-7-3-4-8(2)15(7)11-10(13)5-9(12)6-14-11/h5-8H,3-4,12-13H2,1-2H3 |
| InChIKey | FDCCUJSBMGQICI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine?
The IUPAC name of 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine (CID 21082863) is 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine.
What is the SMILES notation for 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine?
The canonical SMILES for 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine is CC1CCC(C)N1c1ncc(N)cc1N.
What is the InChIKey of 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine?
The InChIKey is FDCCUJSBMGQICI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4/c1-7-3-4-8(2)15(7)11-10(13)5-9(12)6-14-11/h5-8H,3-4,12-13H2,1-2H3.
What are the key properties of 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine?
2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine has a molecular weight of 206.29 g/mol, XLogP of 1.62, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylpyrrolidin-1-yl)pyridine-3,5-diamine is sourced from PubChem (CID 21082863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).