C21H27N4O+ — CID 21082890
8-[(2,6-diethylphenyl)methylamino]-2,3-dimethylimidazo[1,2-a]pyridin-4-ium-4-carboxamide (PubChem CID 21082890) has the molecular formula C21H27N4O+ and a molecular weight of 351.47 g/mol. Its IUPAC name is 8-[(2,6-diethylphenyl)methylamino]-2,3-dimethylimidazo[1,2-a]pyridin-4-ium-4-carboxamide.
| Compound Name | 8-[(2,6-diethylphenyl)methylamino]-2,3-dimethylimidazo[1,2-a]pyridin-4-ium-4-carboxamide |
|---|---|
| PubChem CID | 21082890 |
| Molecular Formula | C21H27N4O+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 8-[(2,6-diethylphenyl)methylamino]-2,3-dimethylimidazo[1,2-a]pyridin-4-ium-4-carboxamide |
| SMILES | CCc1cccc(CC)c1CNC1=CC=C[N+]2(C(N)=O)C1=NC(C)=C2C |
| InChI | InChI=1S/C21H26N4O/c1-5-16-9-7-10-17(6-2)18(16)13-23-19-11-8-12-25(21(22)26)15(4)14(3)24-20(19)25/h7-12,23H,5-6,13H2,1-4H3,(H-,22,26)/p+1 |
| InChIKey | DWKBTJITJNIGGU-UHFFFAOYSA-O |
| XLogP | 3.87 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|