C28H22N6O2 — CID 21082935
4,13-dimorpholin-4-yl-5,14-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene-3,12-dicarbonitrile (PubChem CID 21082935) has the molecular formula C28H22N6O2 and a molecular weight of 474.52 g/mol. Its IUPAC name is 4,13-dimorpholin-4-yl-5,14-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene-3,12-dicarbonitrile.
| Compound Name | 4,13-dimorpholin-4-yl-5,14-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene-3,12-dicarbonitrile |
|---|---|
| PubChem CID | 21082935 |
| Molecular Formula | C28H22N6O2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 4,13-dimorpholin-4-yl-5,14-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene-3,12-dicarbonitrile |
| SMILES | N#Cc1c(N2CCOCC2)nc2cccc3c4c(C#N)c(N5CCOCC5)nc5cccc(c1c23)c54 |
| InChI | InChI=1S/C28H22N6O2/c29-15-19-23-17-3-1-5-21-25(17)24(20(16-30)27(31-21)33-7-11-35-12-8-33)18-4-2-6-22(26(18)23)32-28(19)34-9-13-36-14-10-34/h1-6H,7-14H2 |
| InChIKey | HQZNLFONPSYVGU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 98.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|