About 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide
2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide (PubChem CID 21083175) has the molecular formula C15H21BrN2O2
and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide.
Molecular Properties
| Compound Name | 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide |
| PubChem CID | 21083175 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide |
| SMILES | O=C(O)Cc1ccc(C[N+]23CCN(CC2)CC3)cc1.[Br-] |
| InChI | InChI=1S/C15H20N2O2.BrH/c18-15(19)11-13-1-3-14(4-2-13)12-17-8-5-16(6-9-17)7-10-17;/h1-4H,5-12H2;1H |
| InChIKey | WZMVTUSHFCVSNP-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide?
The IUPAC name of 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide (CID 21083175) is 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide.
What is the SMILES notation for 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide?
The canonical SMILES for 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide is O=C(O)Cc1ccc(C[N+]23CCN(CC2)CC3)cc1.[Br-].
What is the InChIKey of 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide?
The InChIKey is WZMVTUSHFCVSNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2.BrH/c18-15(19)11-13-1-3-14(4-2-13)12-17-8-5-16(6-9-17)7-10-17;/h1-4H,5-12H2;1H.
What are the key properties of 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide?
2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide has a molecular weight of 341.25 g/mol, XLogP of -2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-aza-1-azoniabicyclo[2.2.2]octan-1-ylmethyl)phenyl]acetic acid bromide is sourced from PubChem (CID 21083175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).