About N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide
N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide (PubChem CID 2108377) has the molecular formula C17H12N2OS2
and a molecular weight of 324.43 g/mol. Its IUPAC name is N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide.
Molecular Properties
| Compound Name | N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide |
| PubChem CID | 2108377 |
| Molecular Formula | C17H12N2OS2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1nc2c(ccc3ccccc32)s1 |
| InChI | InChI=1S/C17H12N2OS2/c20-15(10-12-5-3-9-21-12)18-17-19-16-13-6-2-1-4-11(13)7-8-14(16)22-17/h1-9H,10H2,(H,18,19,20) |
| InChIKey | GUAHYFKDIIHKAG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|
Analyze N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide?
The IUPAC name of N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide (CID 2108377) is N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide.
What is the SMILES notation for N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide?
The canonical SMILES for N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide is O=C(Cc1cccs1)Nc1nc2c(ccc3ccccc32)s1.
What is the InChIKey of N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide?
The InChIKey is GUAHYFKDIIHKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2OS2/c20-15(10-12-5-3-9-21-12)18-17-19-16-13-6-2-1-4-11(13)7-8-14(16)22-17/h1-9H,10H2,(H,18,19,20).
What are the key properties of N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide?
N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide has a molecular weight of 324.43 g/mol, XLogP of 4.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzo[e][1,3]benzothiazol-2-yl-2-thiophen-2-ylacetamide is sourced from PubChem (CID 2108377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).