C14H10FN5S — CID 21083789
4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine (PubChem CID 21083789) has the molecular formula C14H10FN5S and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine.
| Compound Name | 4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 21083789 |
| Molecular Formula | C14H10FN5S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
| SMILES | Cn1cnc2c(N)nc3sc(-c4ccc(F)cc4)nc3c21 |
| InChI | InChI=1S/C14H10FN5S/c1-20-6-17-9-11(20)10-14(19-12(9)16)21-13(18-10)7-2-4-8(15)5-3-7/h2-6H,1H3,(H2,16,19) |
| InChIKey | LPPXJBVZCQFRGB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |