C16H15N5OS — CID 21083879
4-(4-methoxyphenyl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine (PubChem CID 21083879) has the molecular formula C16H15N5OS and a molecular weight of 325.40 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine.
| Compound Name | 4-(4-methoxyphenyl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 21083879 |
| Molecular Formula | C16H15N5OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-(4-methoxyphenyl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
| SMILES | CNc1nc2sc(-c3ccc(OC)cc3)nc2c2c1ncn2C |
| InChI | InChI=1S/C16H15N5OS/c1-17-14-11-13(21(2)8-18-11)12-16(20-14)23-15(19-12)9-4-6-10(22-3)7-5-9/h4-8H,1-3H3,(H,17,20) |
| InChIKey | ZNZLRDGWMFXVEE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |