C16H14FN5S — CID 21083906
N-ethyl-4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine (PubChem CID 21083906) has the molecular formula C16H14FN5S and a molecular weight of 327.39 g/mol. Its IUPAC name is N-ethyl-4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine.
| Compound Name | N-ethyl-4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 21083906 |
| Molecular Formula | C16H14FN5S |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-ethyl-4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
| SMILES | CCNc1nc2sc(-c3ccc(F)cc3)nc2c2c1ncn2C |
| InChI | InChI=1S/C16H14FN5S/c1-3-18-14-11-13(22(2)8-19-11)12-16(21-14)23-15(20-12)9-4-6-10(17)7-5-9/h4-8H,3H2,1-2H3,(H,18,21) |
| InChIKey | BNNHUJVLSQMBPR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |