C14H9ClN4O — CID 21083919
8-chloro-12-methyl-4-phenyl-5-oxa-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene (PubChem CID 21083919) has the molecular formula C14H9ClN4O and a molecular weight of 284.71 g/mol. Its IUPAC name is 8-chloro-12-methyl-4-phenyl-5-oxa-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene.
| Compound Name | 8-chloro-12-methyl-4-phenyl-5-oxa-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene |
|---|---|
| PubChem CID | 21083919 |
| Molecular Formula | C14H9ClN4O |
| Molecular Weight | 284.71 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 8-chloro-12-methyl-4-phenyl-5-oxa-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene |
| SMILES | Cn1cnc2c(Cl)nc3oc(-c4ccccc4)nc3c21 |
| InChI | InChI=1S/C14H9ClN4O/c1-19-7-16-9-11(19)10-14(18-12(9)15)20-13(17-10)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | IYTRKRZBIXYLPG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|