About 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine
4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine (PubChem CID 21083920) has the molecular formula C7H6Cl2N4
and a molecular weight of 217.06 g/mol. Its IUPAC name is 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine.
Molecular Properties
| Compound Name | 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine |
| PubChem CID | 21083920 |
| Molecular Formula | C7H6Cl2N4 |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine |
| SMILES | Cn1cnc2c(Cl)nc(Cl)c(N)c21 |
| InChI | InChI=1S/C7H6Cl2N4/c1-13-2-11-4-5(13)3(10)6(8)12-7(4)9/h2H,10H2,1H3 |
| InChIKey | FSUVFALYBDURBY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine?
The IUPAC name of 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine (CID 21083920) is 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine.
What is the SMILES notation for 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine?
The canonical SMILES for 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine is Cn1cnc2c(Cl)nc(Cl)c(N)c21.
What is the InChIKey of 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine?
The InChIKey is FSUVFALYBDURBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2N4/c1-13-2-11-4-5(13)3(10)6(8)12-7(4)9/h2H,10H2,1H3.
What are the key properties of 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine?
4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine has a molecular weight of 217.06 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-1-methylimidazo[4,5-c]pyridin-7-amine is sourced from PubChem (CID 21083920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).