About 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione
2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione (PubChem CID 21084381) has the molecular formula C23H33N5O2
and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione |
| PubChem CID | 21084381 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione |
| SMILES | CCCN(CCC)CCCCN1C(=O)c2ccc(CNCc3ncc[nH]3)cc2C1=O |
| InChI | InChI=1S/C23H33N5O2/c1-3-11-27(12-4-2)13-5-6-14-28-22(29)19-8-7-18(15-20(19)23(28)30)16-24-17-21-25-9-10-26-21/h7-10,15,24H,3-6,11-14,16-17H2,1-2H3,(H,25,26) |
| InChIKey | DEOVXMNDXXAMJK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione?
The IUPAC name of 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione (CID 21084381) is 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione.
What is the SMILES notation for 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione?
The canonical SMILES for 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione is CCCN(CCC)CCCCN1C(=O)c2ccc(CNCc3ncc[nH]3)cc2C1=O.
What is the InChIKey of 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione?
The InChIKey is DEOVXMNDXXAMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33N5O2/c1-3-11-27(12-4-2)13-5-6-14-28-22(29)19-8-7-18(15-20(19)23(28)30)16-24-17-21-25-9-10-26-21/h7-10,15,24H,3-6,11-14,16-17H2,1-2H3,(H,25,26).
What are the key properties of 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione?
2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione has a molecular weight of 411.55 g/mol, XLogP of 3.20, 13 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dipropylamino)butyl]-5-[(1H-imidazol-2-ylmethylamino)methyl]isoindole-1,3-dione is sourced from PubChem (CID 21084381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).