About 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid
2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid (PubChem CID 21084723) has the molecular formula C19H14F3NO3
and a molecular weight of 361.32 g/mol. Its IUPAC name is 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
| PubChem CID | 21084723 |
| Molecular Formula | C19H14F3NO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)Nc2c(F)cc(-c3ccccc3F)cc2F)CCC1 |
| InChI | InChI=1S/C19H14F3NO3/c20-14-7-2-1-4-11(14)10-8-15(21)17(16(22)9-10)23-18(24)12-5-3-6-13(12)19(25)26/h1-2,4,7-9H,3,5-6H2,(H,23,24)(H,25,26) |
| InChIKey | VECFXAQXMBOVIW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid?
The IUPAC name of 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid (CID 21084723) is 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid.
What is the SMILES notation for 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid?
The canonical SMILES for 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid is O=C(O)C1=C(C(=O)Nc2c(F)cc(-c3ccccc3F)cc2F)CCC1.
What is the InChIKey of 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid?
The InChIKey is VECFXAQXMBOVIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3NO3/c20-14-7-2-1-4-11(14)10-8-15(21)17(16(22)9-10)23-18(24)12-5-3-6-13(12)19(25)26/h1-2,4,7-9H,3,5-6H2,(H,23,24)(H,25,26).
What are the key properties of 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid?
2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid has a molecular weight of 361.32 g/mol, XLogP of 4.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,6-difluoro-4-(2-fluorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid is sourced from PubChem (CID 21084723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).