C31H34F2N2O2S — CID 21084903
N-[1-(3,5-difluorophenyl)-4-[[1-(3-ethylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]-3-prop-2-enylsulfanylbenzamide (PubChem CID 21084903) has the molecular formula C31H34F2N2O2S and a molecular weight of 536.69 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)-4-[[1-(3-ethylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]-3-prop-2-enylsulfanylbenzamide.
| Compound Name | N-[1-(3,5-difluorophenyl)-4-[[1-(3-ethylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]-3-prop-2-enylsulfanylbenzamide |
|---|---|
| PubChem CID | 21084903 |
| Molecular Formula | C31H34F2N2O2S |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)-4-[[1-(3-ethylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]-3-prop-2-enylsulfanylbenzamide |
| SMILES | C=CCSc1cccc(C(=O)NC(Cc2cc(F)cc(F)c2)C(O)CNC2(c3cccc(CC)c3)CC2)c1 |
| InChI | InChI=1S/C31H34F2N2O2S/c1-3-13-38-27-10-6-8-23(18-27)30(37)35-28(17-22-15-25(32)19-26(33)16-22)29(36)20-34-31(11-12-31)24-9-5-7-21(4-2)14-24/h3,5-10,14-16,18-19,28-29,34,36H,1,4,11-13,17,20H2,2H3,(H,35,37) |
| InChIKey | QNOJBMXMHKPHBD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|