C28H32F2N2O3S — CID 21085086
N-[1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-4-(methoxymethylsulfanyl)benzamide (PubChem CID 21085086) has the molecular formula C28H32F2N2O3S and a molecular weight of 514.64 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-4-(methoxymethylsulfanyl)benzamide.
| Compound Name | N-[1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-4-(methoxymethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 21085086 |
| Molecular Formula | C28H32F2N2O3S |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-4-(methoxymethylsulfanyl)benzamide |
| SMILES | CCc1cccc(CNCC(O)C(Cc2cc(F)cc(F)c2)NC(=O)c2ccc(SCOC)cc2)c1 |
| InChI | InChI=1S/C28H32F2N2O3S/c1-3-19-5-4-6-20(11-19)16-31-17-27(33)26(14-21-12-23(29)15-24(30)13-21)32-28(34)22-7-9-25(10-8-22)36-18-35-2/h4-13,15,26-27,31,33H,3,14,16-18H2,1-2H3,(H,32,34) |
| InChIKey | JMSLQKYUNIAMHF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|