About 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile
2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile (PubChem CID 21085427) has the molecular formula C14H18N2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile.
Molecular Properties
| Compound Name | 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile |
| PubChem CID | 21085427 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile |
| SMILES | CCCCN1CCc2ccc(C#N)cc2C1 |
| InChI | InChI=1S/C14H18N2/c1-2-3-7-16-8-6-13-5-4-12(10-15)9-14(13)11-16/h4-5,9H,2-3,6-8,11H2,1H3 |
| InChIKey | HWPBJQCGTNVQQO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile?
The IUPAC name of 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile (CID 21085427) is 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile.
What is the SMILES notation for 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile?
The canonical SMILES for 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile is CCCCN1CCc2ccc(C#N)cc2C1.
What is the InChIKey of 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile?
The InChIKey is HWPBJQCGTNVQQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2/c1-2-3-7-16-8-6-13-5-4-12(10-15)9-14(13)11-16/h4-5,9H,2-3,6-8,11H2,1H3.
What are the key properties of 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile?
2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile has a molecular weight of 214.31 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile is sourced from PubChem (CID 21085427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).