C26H28ClF2N3O2 — CID 21085445
2-chloro-N-[1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-6-methylpyridine-4-carboxamide (PubChem CID 21085445) has the molecular formula C26H28ClF2N3O2 and a molecular weight of 487.98 g/mol. Its IUPAC name is 2-chloro-N-[1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-6-methylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-6-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 21085445 |
| Molecular Formula | C26H28ClF2N3O2 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-chloro-N-[1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-6-methylpyridine-4-carboxamide |
| SMILES | CCc1cccc(CNCC(O)C(Cc2cc(F)cc(F)c2)NC(=O)c2cc(C)nc(Cl)c2)c1 |
| InChI | InChI=1S/C26H28ClF2N3O2/c1-3-17-5-4-6-18(8-17)14-30-15-24(33)23(11-19-9-21(28)13-22(29)10-19)32-26(34)20-7-16(2)31-25(27)12-20/h4-10,12-13,23-24,30,33H,3,11,14-15H2,1-2H3,(H,32,34) |
| InChIKey | XYZPXDDWFXFMNX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|