About 3-(2-methylpropyl)-1,2-oxazole
3-(2-methylpropyl)-1,2-oxazole (PubChem CID 21085832) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 3-(2-methylpropyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(2-methylpropyl)-1,2-oxazole |
| PubChem CID | 21085832 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 3-(2-methylpropyl)-1,2-oxazole |
| SMILES | CC(C)Cc1ccon1 |
| InChI | InChI=1S/C7H11NO/c1-6(2)5-7-3-4-9-8-7/h3-4,6H,5H2,1-2H3 |
| InChIKey | VPOHSRKBBFRDGN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-methylpropyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylpropyl)-1,2-oxazole?
The IUPAC name of 3-(2-methylpropyl)-1,2-oxazole (CID 21085832) is 3-(2-methylpropyl)-1,2-oxazole.
What is the SMILES notation for 3-(2-methylpropyl)-1,2-oxazole?
The canonical SMILES for 3-(2-methylpropyl)-1,2-oxazole is CC(C)Cc1ccon1.
What is the InChIKey of 3-(2-methylpropyl)-1,2-oxazole?
The InChIKey is VPOHSRKBBFRDGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-6(2)5-7-3-4-9-8-7/h3-4,6H,5H2,1-2H3.
What are the key properties of 3-(2-methylpropyl)-1,2-oxazole?
3-(2-methylpropyl)-1,2-oxazole has a molecular weight of 125.17 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylpropyl)-1,2-oxazole is sourced from PubChem (CID 21085832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).