C23H27F2N5O4 — CID 21085902
4-(3,5-difluorophenyl)-3-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-1-[(3-methoxyphenyl)methylamino]butan-2-ol (PubChem CID 21085902) has the molecular formula C23H27F2N5O4 and a molecular weight of 475.50 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-3-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-1-[(3-methoxyphenyl)methylamino]butan-2-ol.
| Compound Name | 4-(3,5-difluorophenyl)-3-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-1-[(3-methoxyphenyl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 21085902 |
| Molecular Formula | C23H27F2N5O4 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 4-(3,5-difluorophenyl)-3-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-1-[(3-methoxyphenyl)methylamino]butan-2-ol |
| SMILES | COc1cccc(CNCC(O)C(Cc2cc(F)cc(F)c2)Nc2c([N+](=O)[O-])c(C)nn2C)c1 |
| InChI | InChI=1S/C23H27F2N5O4/c1-14-22(30(32)33)23(29(2)28-14)27-20(10-16-7-17(24)11-18(25)8-16)21(31)13-26-12-15-5-4-6-19(9-15)34-3/h4-9,11,20-21,26-27,31H,10,12-13H2,1-3H3 |
| InChIKey | JJIJVWPZDSKNSN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|