About Elronon
Elronon (PubChem CID 21086) has the molecular formula C19H23ClN2O
and a molecular weight of 330.80 g/mol. Its IUPAC name is dimethyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylideneamino)oxyethyl]azanium chloride.
Molecular Properties
| Compound Name | Elronon |
| PubChem CID | 21086 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | dimethyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylideneamino)oxyethyl]azanium chloride |
| SMILES | C[NH+](C)CCON=C1C2=CC=CC=C2CCC3=CC=CC=C31.[Cl-] |
| InChI | InChI=1S/C19H22N2O.ClH/c1-21(2)13-14-22-20-19-17-9-5-3-7-15(17)11-12-16-8-4-6-10-18(16)19;/h3-10H,11-14H2,1-2H3;1H |
| InChIKey | JIKBYFBMUAUPJS-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 26.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 354 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Elronon with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Elronon?
The IUPAC name of Elronon (CID 21086) is dimethyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylideneamino)oxyethyl]azanium chloride.
What is the SMILES notation for Elronon?
The canonical SMILES for Elronon is C[NH+](C)CCON=C1C2=CC=CC=C2CCC3=CC=CC=C31.[Cl-].
What is the InChIKey of Elronon?
The InChIKey is JIKBYFBMUAUPJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O.ClH/c1-21(2)13-14-22-20-19-17-9-5-3-7-15(17)11-12-16-8-4-6-10-18(16)19;/h3-10H,11-14H2,1-2H3;1H.
What are the key properties of Elronon?
Elronon has a molecular weight of 330.80 g/mol, XLogP of not available, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Elronon is sourced from PubChem (CID 21086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).