C21H31N6OS+ — CID 2108620
1-(3-morpholin-4-ium-4-ylpropyl)-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea (PubChem CID 2108620) has the molecular formula C21H31N6OS+ and a molecular weight of 415.59 g/mol. Its IUPAC name is 1-(3-morpholin-4-ium-4-ylpropyl)-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea.
| Compound Name | 1-(3-morpholin-4-ium-4-ylpropyl)-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 2108620 |
| Molecular Formula | C21H31N6OS+ |
| Molecular Weight | 415.59 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 1-(3-morpholin-4-ium-4-ylpropyl)-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
| SMILES | S=C(NCCC[NH+]1CCOCC1)Nc1cccc(-c2nnc3n2CCCCC3)c1 |
| InChI | InChI=1S/C21H30N6OS/c29-21(22-9-5-10-26-12-14-28-15-13-26)23-18-7-4-6-17(16-18)20-25-24-19-8-2-1-3-11-27(19)20/h4,6-7,16H,1-3,5,8-15H2,(H2,22,23,29)/p+1 |
| InChIKey | VSUKTTHFYFFCJU-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.59 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|