C37H44F2N4O4 — CID 21086330
1-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-propan-2-ylphenyl)methylamino]butan-2-yl]-5-(1,3-oxazol-2-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 21086330) has the molecular formula C37H44F2N4O4 and a molecular weight of 646.78 g/mol. Its IUPAC name is 1-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-propan-2-ylphenyl)methylamino]butan-2-yl]-5-(1,3-oxazol-2-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-propan-2-ylphenyl)methylamino]butan-2-yl]-5-(1,3-oxazol-2-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 21086330 |
| Molecular Formula | C37H44F2N4O4 |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | 1-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-propan-2-ylphenyl)methylamino]butan-2-yl]-5-(1,3-oxazol-2-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(=O)NC(Cc2cc(F)cc(F)c2)C(O)CNCc2cccc(C(C)C)c2)cc(-c2ncco2)c1 |
| InChI | InChI=1S/C37H44F2N4O4/c1-5-11-43(12-6-2)37(46)30-19-28(18-29(20-30)36-41-10-13-47-36)35(45)42-33(17-26-15-31(38)21-32(39)16-26)34(44)23-40-22-25-8-7-9-27(14-25)24(3)4/h7-10,13-16,18-21,24,33-34,40,44H,5-6,11-12,17,22-23H2,1-4H3,(H,42,45) |
| InChIKey | YTLYFNKFIKWXGL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |