C30H27F3N2O — CID 21087521
N-[[1-ethyl-3-[4-(trifluoromethoxy)phenyl]indol-5-yl]methyl]-1-naphthalen-1-ylethanamine (PubChem CID 21087521) has the molecular formula C30H27F3N2O and a molecular weight of 488.55 g/mol. Its IUPAC name is N-[[1-ethyl-3-[4-(trifluoromethoxy)phenyl]indol-5-yl]methyl]-1-naphthalen-1-ylethanamine.
| Compound Name | N-[[1-ethyl-3-[4-(trifluoromethoxy)phenyl]indol-5-yl]methyl]-1-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 21087521 |
| Molecular Formula | C30H27F3N2O |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | N-[[1-ethyl-3-[4-(trifluoromethoxy)phenyl]indol-5-yl]methyl]-1-naphthalen-1-ylethanamine |
| SMILES | CCn1cc(-c2ccc(OC(F)(F)F)cc2)c2cc(CNC(C)c3cccc4ccccc34)ccc21 |
| InChI | InChI=1S/C30H27F3N2O/c1-3-35-19-28(23-12-14-24(15-13-23)36-30(31,32)33)27-17-21(11-16-29(27)35)18-34-20(2)25-10-6-8-22-7-4-5-9-26(22)25/h4-17,19-20,34H,3,18H2,1-2H3 |
| InChIKey | UAYJUEGZICIJMT-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |