C21H28N4O4 — CID 2108764
2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 2108764) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2108764 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)Nc1ccc(N3CCOCC3)cc1)C2=O |
| InChI | InChI=1S/C21H28N4O4/c1-15-6-8-21(9-7-15)19(27)25(20(28)23-21)14-18(26)22-16-2-4-17(5-3-16)24-10-12-29-13-11-24/h2-5,15H,6-14H2,1H3,(H,22,26)(H,23,28) |
| InChIKey | YEDYVDQYUQQGMQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|