C20H11Cl2F6N3O — CID 21087776
1-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-chlorotriazol-4-yl]-3-(2-chlorophenyl)prop-2-yn-1-ol (PubChem CID 21087776) has the molecular formula C20H11Cl2F6N3O and a molecular weight of 494.22 g/mol. Its IUPAC name is 1-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-chlorotriazol-4-yl]-3-(2-chlorophenyl)prop-2-yn-1-ol.
| Compound Name | 1-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-chlorotriazol-4-yl]-3-(2-chlorophenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 21087776 |
| Molecular Formula | C20H11Cl2F6N3O |
| Molecular Weight | 494.22 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | 1-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-chlorotriazol-4-yl]-3-(2-chlorophenyl)prop-2-yn-1-ol |
| SMILES | OC(C#Cc1ccccc1Cl)c1nnn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1Cl |
| InChI | InChI=1S/C20H11Cl2F6N3O/c21-15-4-2-1-3-12(15)5-6-16(32)17-18(22)31(30-29-17)10-11-7-13(19(23,24)25)9-14(8-11)20(26,27)28/h1-4,7-9,16,32H,10H2 |
| InChIKey | OHZXGKBWMOQSFD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.22 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|