C30H31N4O4PS — CID 21088554
3-[4-[3-[2-(benzimidazol-1-yl)-4-phenyl-1,3-thiazol-5-yl]propanoylamino]phenyl]pentan-3-ylphosphonic acid (PubChem CID 21088554) has the molecular formula C30H31N4O4PS and a molecular weight of 574.64 g/mol. Its IUPAC name is 3-[4-[3-[2-(benzimidazol-1-yl)-4-phenyl-1,3-thiazol-5-yl]propanoylamino]phenyl]pentan-3-ylphosphonic acid.
| Compound Name | 3-[4-[3-[2-(benzimidazol-1-yl)-4-phenyl-1,3-thiazol-5-yl]propanoylamino]phenyl]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 21088554 |
| Molecular Formula | C30H31N4O4PS |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 3-[4-[3-[2-(benzimidazol-1-yl)-4-phenyl-1,3-thiazol-5-yl]propanoylamino]phenyl]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(c1ccc(NC(=O)CCc2sc(-n3cnc4ccccc43)nc2-c2ccccc2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C30H31N4O4PS/c1-3-30(4-2,39(36,37)38)22-14-16-23(17-15-22)32-27(35)19-18-26-28(21-10-6-5-7-11-21)33-29(40-26)34-20-31-24-12-8-9-13-25(24)34/h5-17,20H,3-4,18-19H2,1-2H3,(H,32,35)(H2,36,37,38) |
| InChIKey | OYTWSPLONWSTDD-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|