C22H18ClF2N3O4 — CID 21089150
3-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-2-(prop-2-enylamino)pyrimidin-1-yl]-4-methylbenzoic acid (PubChem CID 21089150) has the molecular formula C22H18ClF2N3O4 and a molecular weight of 461.85 g/mol. Its IUPAC name is 3-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-2-(prop-2-enylamino)pyrimidin-1-yl]-4-methylbenzoic acid.
| Compound Name | 3-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-2-(prop-2-enylamino)pyrimidin-1-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 21089150 |
| Molecular Formula | C22H18ClF2N3O4 |
| Molecular Weight | 461.85 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 3-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-2-(prop-2-enylamino)pyrimidin-1-yl]-4-methylbenzoic acid |
| SMILES | C=CCNc1nc(OCc2ccc(F)cc2F)c(Cl)c(=O)n1-c1cc(C(=O)O)ccc1C |
| InChI | InChI=1S/C22H18ClF2N3O4/c1-3-8-26-22-27-19(32-11-14-6-7-15(24)10-16(14)25)18(23)20(29)28(22)17-9-13(21(30)31)5-4-12(17)2/h3-7,9-10H,1,8,11H2,2H3,(H,26,27)(H,30,31) |
| InChIKey | NKNPWXVXOAKNSW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.85 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|