About [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid
[3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid (PubChem CID 21089249) has the molecular formula C20H16BrF2N3O4
and a molecular weight of 480.27 g/mol. Its IUPAC name is [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid.
Molecular Properties
| Compound Name | [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid |
| PubChem CID | 21089249 |
| Molecular Formula | C20H16BrF2N3O4 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid |
| SMILES | Cc1nc(OCc2ccc(F)cc2F)c(Br)c(=O)n1-c1cccc(CNC(=O)O)c1 |
| InChI | InChI=1S/C20H16BrF2N3O4/c1-11-25-18(30-10-13-5-6-14(22)8-16(13)23)17(21)19(27)26(11)15-4-2-3-12(7-15)9-24-20(28)29/h2-8,24H,9-10H2,1H3,(H,28,29) |
| InChIKey | YKNIVYXYWDEHBF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid?
The IUPAC name of [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid (CID 21089249) is [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid.
What is the SMILES notation for [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid?
The canonical SMILES for [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid is Cc1nc(OCc2ccc(F)cc2F)c(Br)c(=O)n1-c1cccc(CNC(=O)O)c1.
What is the InChIKey of [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid?
The InChIKey is YKNIVYXYWDEHBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16BrF2N3O4/c1-11-25-18(30-10-13-5-6-14(22)8-16(13)23)17(21)19(27)26(11)15-4-2-3-12(7-15)9-24-20(28)29/h2-8,24H,9-10H2,1H3,(H,28,29).
What are the key properties of [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid?
[3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid has a molecular weight of 480.27 g/mol, XLogP of 3.93, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]phenyl]methylcarbamic acid is sourced from PubChem (CID 21089249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).