About 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one
5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one (PubChem CID 21089691) has the molecular formula C17H13BrF2N4O2
and a molecular weight of 423.22 g/mol. Its IUPAC name is 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one |
| PubChem CID | 21089691 |
| Molecular Formula | C17H13BrF2N4O2 |
| Molecular Weight | 423.22 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one |
| SMILES | Cc1nc(OCc2ccc(F)cc2F)c(Br)c(=O)n1Cc1cnccn1 |
| InChI | InChI=1S/C17H13BrF2N4O2/c1-10-23-16(26-9-11-2-3-12(19)6-14(11)20)15(18)17(25)24(10)8-13-7-21-4-5-22-13/h2-7H,8-9H2,1H3 |
| InChIKey | KWYFERLTXSLJIR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one?
The IUPAC name of 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one (CID 21089691) is 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one.
What is the SMILES notation for 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one?
The canonical SMILES for 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one is Cc1nc(OCc2ccc(F)cc2F)c(Br)c(=O)n1Cc1cnccn1.
What is the InChIKey of 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one?
The InChIKey is KWYFERLTXSLJIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrF2N4O2/c1-10-23-16(26-9-11-2-3-12(19)6-14(11)20)15(18)17(25)24(10)8-13-7-21-4-5-22-13/h2-7H,8-9H2,1H3.
What are the key properties of 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one?
5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one has a molecular weight of 423.22 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-methyl-3-(pyrazin-2-ylmethyl)pyrimidin-4-one is sourced from PubChem (CID 21089691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).