C20H16BrFN2O4 — CID 21090181
methyl 2-[[5-bromo-4-[(4-fluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoate (PubChem CID 21090181) has the molecular formula C20H16BrFN2O4 and a molecular weight of 447.26 g/mol. Its IUPAC name is methyl 2-[[5-bromo-4-[(4-fluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[[5-bromo-4-[(4-fluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 21090181 |
| Molecular Formula | C20H16BrFN2O4 |
| Molecular Weight | 447.26 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | methyl 2-[[5-bromo-4-[(4-fluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1Cn1cnc(OCc2ccc(F)cc2)c(Br)c1=O |
| InChI | InChI=1S/C20H16BrFN2O4/c1-27-20(26)16-5-3-2-4-14(16)10-24-12-23-18(17(21)19(24)25)28-11-13-6-8-15(22)9-7-13/h2-9,12H,10-11H2,1H3 |
| InChIKey | JPZWIDJENMVPKW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |