C20H20F3N3O5S — CID 21090684
1,1,1-trifluoro-N-[2-[4-[3-methoxy-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl]methanesulfonamide (PubChem CID 21090684) has the molecular formula C20H20F3N3O5S and a molecular weight of 471.46 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-[4-[3-methoxy-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-[4-[3-methoxy-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 21090684 |
| Molecular Formula | C20H20F3N3O5S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-[4-[3-methoxy-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl]methanesulfonamide |
| SMILES | COc1ccc(-n2nc(OC)cc2-c2ccc(OCCNS(=O)(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H20F3N3O5S/c1-29-16-9-5-15(6-10-16)26-18(13-19(25-26)30-2)14-3-7-17(8-4-14)31-12-11-24-32(27,28)20(21,22)23/h3-10,13,24H,11-12H2,1-2H3 |
| InChIKey | LUIAHMMBXBXLKL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|