C13H14N2O3S — CID 2109069
3,4-dimethoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 2109069) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2109069 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3,4-dimethoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ncc(C)s2)cc1OC |
| InChI | InChI=1S/C13H14N2O3S/c1-8-7-14-13(19-8)15-12(16)9-4-5-10(17-2)11(6-9)18-3/h4-7H,1-3H3,(H,14,15,16) |
| InChIKey | PQGIEIZYRGMWMM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |