About 2-tritioadamantane
2-tritioadamantane (PubChem CID 21091204) has the molecular formula C10H16
and a molecular weight of 138.25 g/mol. Its IUPAC name is 2-tritioadamantane.
Molecular Properties
| Compound Name | 2-tritioadamantane |
| PubChem CID | 21091204 |
| Molecular Formula | C10H16 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.13 |
| IUPAC Name | 2-tritioadamantane |
| SMILES | [3H]C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C10H16/c1-7-2-9-4-8(1)5-10(3-7)6-9/h7-10H,1-6H2/i1T |
| InChIKey | ORILYTVJVMAKLC-CNRUNOGKSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tritioadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tritioadamantane?
The IUPAC name of 2-tritioadamantane (CID 21091204) is 2-tritioadamantane.
What is the SMILES notation for 2-tritioadamantane?
The canonical SMILES for 2-tritioadamantane is [3H]C1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-tritioadamantane?
The InChIKey is ORILYTVJVMAKLC-CNRUNOGKSA-N. The full InChI is InChI=1S/C10H16/c1-7-2-9-4-8(1)5-10(3-7)6-9/h7-10H,1-6H2/i1T.
What are the key properties of 2-tritioadamantane?
2-tritioadamantane has a molecular weight of 138.25 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tritioadamantane is sourced from PubChem (CID 21091204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).