About N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide (PubChem CID 21092408) has the molecular formula C22H25N3O2S
and a molecular weight of 395.53 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide.
Molecular Properties
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide |
| PubChem CID | 21092408 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NCCCCN1CCc2ccccc2C1)c1cccc2cccnc12 |
| InChI | InChI=1S/C22H25N3O2S/c26-28(27,21-11-5-9-19-10-6-13-23-22(19)21)24-14-3-4-15-25-16-12-18-7-1-2-8-20(18)17-25/h1-2,5-11,13,24H,3-4,12,14-17H2 |
| InChIKey | ZYPBXZBFNWMVPU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide?
The IUPAC name of N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide (CID 21092408) is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide.
What is the SMILES notation for N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide?
The canonical SMILES for N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide is O=S(=O)(NCCCCN1CCc2ccccc2C1)c1cccc2cccnc12.
What is the InChIKey of N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide?
The InChIKey is ZYPBXZBFNWMVPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O2S/c26-28(27,21-11-5-9-19-10-6-13-23-22(19)21)24-14-3-4-15-25-16-12-18-7-1-2-8-20(18)17-25/h1-2,5-11,13,24H,3-4,12,14-17H2.
What are the key properties of N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide?
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide has a molecular weight of 395.53 g/mol, XLogP of 3.35, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide is sourced from PubChem (CID 21092408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).