About ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate
ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate (PubChem CID 21092810) has the molecular formula C14H18N4O4S2
and a molecular weight of 370.46 g/mol. Its IUPAC name is ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate |
| PubChem CID | 21092810 |
| Molecular Formula | C14H18N4O4S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate |
| SMILES | CCOC(=O)CNCCNS(=O)(=O)c1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C14H18N4O4S2/c1-2-22-12(19)10-15-8-9-16-24(20,21)14-18-17-13(23-14)11-6-4-3-5-7-11/h3-7,15-16H,2,8-10H2,1H3 |
| InChIKey | SGHLMMVCFGYXCV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate?
The IUPAC name of ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate (CID 21092810) is ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate.
What is the SMILES notation for ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate?
The canonical SMILES for ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate is CCOC(=O)CNCCNS(=O)(=O)c1nnc(-c2ccccc2)s1.
What is the InChIKey of ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate?
The InChIKey is SGHLMMVCFGYXCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O4S2/c1-2-22-12(19)10-15-8-9-16-24(20,21)14-18-17-13(23-14)11-6-4-3-5-7-11/h3-7,15-16H,2,8-10H2,1H3.
What are the key properties of ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate?
ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate has a molecular weight of 370.46 g/mol, XLogP of 0.64, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfonylamino]ethylamino]acetate is sourced from PubChem (CID 21092810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).