C26H25N3O5 — CID 21092894
N-[1-(4-methoxybenzoyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 21092894) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is N-[1-(4-methoxybenzoyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | N-[1-(4-methoxybenzoyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 21092894 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[1-(4-methoxybenzoyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | COc1ccc(C(=O)N2c3ccccc3C(N(C(C)=O)c3ccc([N+](=O)[O-])cc3)CC2C)cc1 |
| InChI | InChI=1S/C26H25N3O5/c1-17-16-25(28(18(2)30)20-10-12-21(13-11-20)29(32)33)23-6-4-5-7-24(23)27(17)26(31)19-8-14-22(34-3)15-9-19/h4-15,17,25H,16H2,1-3H3 |
| InChIKey | REJXUUGASNYVFA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|