C12H2BrF15O3S — CID 21093208
1-(5-bromothiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethanone (PubChem CID 21093208) has the molecular formula C12H2BrF15O3S and a molecular weight of 591.09 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethanone.
| Compound Name | 1-(5-bromothiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethanone |
|---|---|
| PubChem CID | 21093208 |
| Molecular Formula | C12H2BrF15O3S |
| Molecular Weight | 591.09 g/mol |
| Exact Mass | 589.87 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethanone |
| SMILES | O=C(c1ccc(Br)s1)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H2BrF15O3S/c13-4-2-1-3(32-4)5(29)6(14,15)30-11(25,26)12(27,28)31-10(23,24)8(18,19)7(16,17)9(20,21)22/h1-2H |
| InChIKey | CLSRTQYMGHDCMM-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.09 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|