C12H3F15O3S — CID 21093209
2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-1-thiophen-2-ylethanone (PubChem CID 21093209) has the molecular formula C12H3F15O3S and a molecular weight of 512.19 g/mol. Its IUPAC name is 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-1-thiophen-2-ylethanone.
| Compound Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 21093209 |
| Molecular Formula | C12H3F15O3S |
| Molecular Weight | 512.19 g/mol |
| Exact Mass | 511.96 |
| IUPAC Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-1-thiophen-2-ylethanone |
| SMILES | O=C(c1cccs1)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3F15O3S/c13-6(14,5(28)4-2-1-3-31-4)29-11(24,25)12(26,27)30-10(22,23)8(17,18)7(15,16)9(19,20)21/h1-3H |
| InChIKey | USJPGILAQRACEO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.19 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|