C17H4BrF17O3S2 — CID 21093214
1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one (PubChem CID 21093214) has the molecular formula C17H4BrF17O3S2 and a molecular weight of 723.22 g/mol. Its IUPAC name is 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one.
| Compound Name | 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one |
|---|---|
| PubChem CID | 21093214 |
| Molecular Formula | C17H4BrF17O3S2 |
| Molecular Weight | 723.22 g/mol |
| Exact Mass | 721.85 |
| IUPAC Name | 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one |
| SMILES | O=C(c1ccc(-c2ccc(Br)s2)s1)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H4BrF17O3S2/c18-8-4-3-6(40-8)5-1-2-7(39-5)9(36)10(19,13(23,24)25)37-17(34,35)12(22,15(29,30)31)38-16(32,33)11(20,21)14(26,27)28/h1-4H |
| InChIKey | ZYVYTLBFQLJEAU-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.22 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|