C15H4BrF13O4S2 — CID 21093215
1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone (PubChem CID 21093215) has the molecular formula C15H4BrF13O4S2 and a molecular weight of 639.20 g/mol. Its IUPAC name is 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone.
| Compound Name | 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone |
|---|---|
| PubChem CID | 21093215 |
| Molecular Formula | C15H4BrF13O4S2 |
| Molecular Weight | 639.20 g/mol |
| Exact Mass | 637.85 |
| IUPAC Name | 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone |
| SMILES | O=C(c1ccc(-c2ccc(Br)s2)s1)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C15H4BrF13O4S2/c16-8-4-3-6(35-8)5-1-2-7(34-5)9(30)10(17,18)31-11(19,20)12(21,22)32-13(23,24)14(25,26)33-15(27,28)29/h1-4H |
| InChIKey | OWCXYCXDRYIAJU-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.20 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|