C16H4BrF15O3S2 — CID 21093216
1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethanone (PubChem CID 21093216) has the molecular formula C16H4BrF15O3S2 and a molecular weight of 673.21 g/mol. Its IUPAC name is 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethanone.
| Compound Name | 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethanone |
|---|---|
| PubChem CID | 21093216 |
| Molecular Formula | C16H4BrF15O3S2 |
| Molecular Weight | 673.21 g/mol |
| Exact Mass | 671.85 |
| IUPAC Name | 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethanone |
| SMILES | O=C(c1ccc(-c2ccc(Br)s2)s1)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H4BrF15O3S2/c17-8-4-3-6(37-8)5-1-2-7(36-5)9(33)10(18,19)34-15(29,30)16(31,32)35-14(27,28)12(22,23)11(20,21)13(24,25)26/h1-4H |
| InChIKey | RWROGDBJIBAZLR-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.21 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|