C15H5F13O4S2 — CID 21093219
2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-(5-thiophen-2-ylthiophen-2-yl)ethanone (PubChem CID 21093219) has the molecular formula C15H5F13O4S2 and a molecular weight of 560.31 g/mol. Its IUPAC name is 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-(5-thiophen-2-ylthiophen-2-yl)ethanone.
| Compound Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-(5-thiophen-2-ylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 21093219 |
| Molecular Formula | C15H5F13O4S2 |
| Molecular Weight | 560.31 g/mol |
| Exact Mass | 559.94 |
| IUPAC Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-(5-thiophen-2-ylthiophen-2-yl)ethanone |
| SMILES | O=C(c1ccc(-c2cccs2)s1)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C15H5F13O4S2/c16-10(17,9(29)8-4-3-7(34-8)6-2-1-5-33-6)30-11(18,19)12(20,21)31-13(22,23)14(24,25)32-15(26,27)28/h1-5H |
| InChIKey | NAEQPZVKNIQWCI-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.31 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|