About 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride
8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride (PubChem CID 21093517) has the molecular formula C14H11ClF3N3
and a molecular weight of 313.71 g/mol. Its IUPAC name is 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride.
Molecular Properties
| Compound Name | 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride |
| PubChem CID | 21093517 |
| Molecular Formula | C14H11ClF3N3 |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride |
| SMILES | Cl.NC1=Nc2ccccc2Nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H10F3N3.ClH/c15-14(16,17)8-5-6-10-9(7-8)13(18)20-12-4-2-1-3-11(12)19-10;/h1-7,19H,(H2,18,20);1H |
| InChIKey | KISHROATUQYCGC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride?
The IUPAC name of 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride (CID 21093517) is 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride.
What is the SMILES notation for 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride?
The canonical SMILES for 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride is Cl.NC1=Nc2ccccc2Nc2ccc(C(F)(F)F)cc21.
What is the InChIKey of 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride?
The InChIKey is KISHROATUQYCGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N3.ClH/c15-14(16,17)8-5-6-10-9(7-8)13(18)20-12-4-2-1-3-11(12)19-10;/h1-7,19H,(H2,18,20);1H.
What are the key properties of 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride?
8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride has a molecular weight of 313.71 g/mol, XLogP of 4.22, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine;hydrochloride is sourced from PubChem (CID 21093517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).