C17H19ClN4O3 — CID 21093792
2-chloro-N-(cyclohexylmethyl)-5-(3,5-dioxo-1,2,4-triazin-2-yl)benzamide (PubChem CID 21093792) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is 2-chloro-N-(cyclohexylmethyl)-5-(3,5-dioxo-1,2,4-triazin-2-yl)benzamide.
| Compound Name | 2-chloro-N-(cyclohexylmethyl)-5-(3,5-dioxo-1,2,4-triazin-2-yl)benzamide |
|---|---|
| PubChem CID | 21093792 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-chloro-N-(cyclohexylmethyl)-5-(3,5-dioxo-1,2,4-triazin-2-yl)benzamide |
| SMILES | O=C(NCC1CCCCC1)c1cc(-n2ncc(=O)[nH]c2=O)ccc1Cl |
| InChI | InChI=1S/C17H19ClN4O3/c18-14-7-6-12(22-17(25)21-15(23)10-20-22)8-13(14)16(24)19-9-11-4-2-1-3-5-11/h6-8,10-11H,1-5,9H2,(H,19,24)(H,21,23,25) |
| InChIKey | IMCCOPOXIDIESM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |