C16H19ClN4O3 — CID 21093814
2-chloro-5-(3,5-dioxo-1,2,4-triazin-2-yl)-N-hexylbenzamide (PubChem CID 21093814) has the molecular formula C16H19ClN4O3 and a molecular weight of 350.81 g/mol. Its IUPAC name is 2-chloro-5-(3,5-dioxo-1,2,4-triazin-2-yl)-N-hexylbenzamide.
| Compound Name | 2-chloro-5-(3,5-dioxo-1,2,4-triazin-2-yl)-N-hexylbenzamide |
|---|---|
| PubChem CID | 21093814 |
| Molecular Formula | C16H19ClN4O3 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-chloro-5-(3,5-dioxo-1,2,4-triazin-2-yl)-N-hexylbenzamide |
| SMILES | CCCCCCNC(=O)c1cc(-n2ncc(=O)[nH]c2=O)ccc1Cl |
| InChI | InChI=1S/C16H19ClN4O3/c1-2-3-4-5-8-18-15(23)12-9-11(6-7-13(12)17)21-16(24)20-14(22)10-19-21/h6-7,9-10H,2-5,8H2,1H3,(H,18,23)(H,20,22,24) |
| InChIKey | AVXMCRMRXVBJIW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|