C10H13ClN2O — CID 21094
2-(2-oxo-1,3-dihydroindol-3-yl)ethylazanium chloride (PubChem CID 21094) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-(2-oxo-1,3-dihydroindol-3-yl)ethylazanium chloride.
| Compound Name | 2-(2-oxo-1,3-dihydroindol-3-yl)ethylazanium chloride |
|---|---|
| PubChem CID | 21094 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-(2-oxo-1,3-dihydroindol-3-yl)ethylazanium chloride |
| SMILES | [Cl-].[NH3+]CCC1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H12N2O.ClH/c11-6-5-8-7-3-1-2-4-9(7)12-10(8)13;/h1-4,8H,5-6,11H2,(H,12,13);1H |
| InChIKey | TXSFUPUQVBZDAA-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |