About 8H-pyrido[2,3-h][1,4]benzoxazine
8H-pyrido[2,3-h][1,4]benzoxazine (PubChem CID 21094332) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 8H-pyrido[2,3-h][1,4]benzoxazine.
Molecular Properties
| Compound Name | 8H-pyrido[2,3-h][1,4]benzoxazine |
| PubChem CID | 21094332 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 8H-pyrido[2,3-h][1,4]benzoxazine |
| SMILES | C1=Cc2c3c(ccc2=NC1)=NC=CO3 |
| InChI | InChI=1S/C11H8N2O/c1-2-8-9(12-5-1)3-4-10-11(8)14-7-6-13-10/h1-4,6-7H,5H2 |
| InChIKey | JOAXUKMSFADSLV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 8H-pyrido[2,3-h][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8H-pyrido[2,3-h][1,4]benzoxazine?
The IUPAC name of 8H-pyrido[2,3-h][1,4]benzoxazine (CID 21094332) is 8H-pyrido[2,3-h][1,4]benzoxazine.
What is the SMILES notation for 8H-pyrido[2,3-h][1,4]benzoxazine?
The canonical SMILES for 8H-pyrido[2,3-h][1,4]benzoxazine is C1=Cc2c3c(ccc2=NC1)=NC=CO3.
What is the InChIKey of 8H-pyrido[2,3-h][1,4]benzoxazine?
The InChIKey is JOAXUKMSFADSLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c1-2-8-9(12-5-1)3-4-10-11(8)14-7-6-13-10/h1-4,6-7H,5H2.
What are the key properties of 8H-pyrido[2,3-h][1,4]benzoxazine?
8H-pyrido[2,3-h][1,4]benzoxazine has a molecular weight of 184.20 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8H-pyrido[2,3-h][1,4]benzoxazine is sourced from PubChem (CID 21094332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).