About 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine
2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine (PubChem CID 21094663) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine |
| PubChem CID | 21094663 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine |
| SMILES | [H]/N=c1\c2ccccc2nc2n1CCC2 |
| InChI | InChI=1S/C11H11N3/c12-11-8-4-1-2-5-9(8)13-10-6-3-7-14(10)11/h1-2,4-5,12H,3,6-7H2/b12-11+ |
| InChIKey | AOSPPBURKIEYRC-VAWYXSNFSA-N |
| XLogP | 1.46 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine?
The IUPAC name of 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine (CID 21094663) is 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine.
What is the SMILES notation for 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine?
The canonical SMILES for 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine is [H]/N=c1\c2ccccc2nc2n1CCC2.
What is the InChIKey of 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine?
The InChIKey is AOSPPBURKIEYRC-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H11N3/c12-11-8-4-1-2-5-9(8)13-10-6-3-7-14(10)11/h1-2,4-5,12H,3,6-7H2/b12-11+.
What are the key properties of 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine?
2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine has a molecular weight of 185.23 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-imine is sourced from PubChem (CID 21094663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).