C33H41F2N3O4 — CID 21094775
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 21094775) has the molecular formula C33H41F2N3O4 and a molecular weight of 581.70 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 21094775 |
| Molecular Formula | C33H41F2N3O4 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCC(O)c2ccccc2)c1 |
| InChI | InChI=1S/C33H41F2N3O4/c1-4-11-38(12-5-2)33(42)26-14-22(3)13-25(18-26)32(41)37-29(17-23-15-27(34)19-28(35)16-23)31(40)21-36-20-30(39)24-9-7-6-8-10-24/h6-10,13-16,18-19,29-31,36,39-40H,4-5,11-12,17,20-21H2,1-3H3,(H,37,41)/t29-,30?,31+/m0/s1 |
| InChIKey | FJNJWKRSZDQUIX-GAGJGVLVSA-N |
| XLogP | 4.56 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |