About 2-amino-1,3-oxazole-4-carboxamide
2-amino-1,3-oxazole-4-carboxamide (PubChem CID 21094800) has the molecular formula C4H5N3O2
and a molecular weight of 127.10 g/mol. Its IUPAC name is 2-amino-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-amino-1,3-oxazole-4-carboxamide |
| PubChem CID | 21094800 |
| Molecular Formula | C4H5N3O2 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 2-amino-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1coc(N)n1 |
| InChI | InChI=1S/C4H5N3O2/c5-3(8)2-1-9-4(6)7-2/h1H,(H2,5,8)(H2,6,7) |
| InChIKey | DMUQIMMDFYYYNS-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-amino-1,3-oxazole-4-carboxamide (CID 21094800) is 2-amino-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-amino-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-amino-1,3-oxazole-4-carboxamide is NC(=O)c1coc(N)n1.
What is the InChIKey of 2-amino-1,3-oxazole-4-carboxamide?
The InChIKey is DMUQIMMDFYYYNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2/c5-3(8)2-1-9-4(6)7-2/h1H,(H2,5,8)(H2,6,7).
What are the key properties of 2-amino-1,3-oxazole-4-carboxamide?
2-amino-1,3-oxazole-4-carboxamide has a molecular weight of 127.10 g/mol, XLogP of -0.64, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 21094800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).